Phthalic acid, puriss. p.a., ≥99.5% (T), 80010-1KG
Catalog/Part Number:: 80010-1KG
₦245,340.00
Description
General description
Phthalic acid (1,2-benzenedicarboxylic acid) is an aromatic
dicarboxylic acid. On heating, it undergoes dehydration to afford cyclic
anhydride. It can be synthesized from phthalic anhydride.[1]
Application
Phthalic acid may be used in the synthesis of benzoic acid.[1] It
may be used to constitute the mobile phase during hydrophilic interaction
liquid chromatography (HILIC) coupled with electrospray ionization tandem mass
spectrometric (ESI-MS/MS) analysis of free amino acids (AAs) in human thyroid
tissues.[2]
Technical Specifications
| Related Categories | Acids, Acids & Bases, Analytical Reagents, Analytical Reagents for General Use, Analytical/Chromatography, |
| More... | |
| Quality Level | 200 |
| grade | puriss. p.a. |
| assay | ≥99.5% (T) |
| form | powder or crystals |
| ign. residue | ≤0.02% (as SO4) |
| mp | 210-211 °C (dec.) (lit.) |
| solubility | water: soluble(lit.) |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| SMILES string | OC(C1=C(C(O)=O)C=CC=C1)=O |
| InChI | 1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChI key | XNGIFLGASWRNHJ-UHFFFAOYSA-N |
Zero(0) Reviews